C36H25N3O — CID 155052962
(2E)-2-[[1,1,3-trimethyl-6-[4-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)phenyl]inden-2-yl]methylidene]but-3-ynenitrile (PubChem CID 155052962) has the molecular formula C36H25N3O and a molecular weight of 515.62 g/mol. Its IUPAC name is (2E)-2-[[1,1,3-trimethyl-6-[4-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)phenyl]inden-2-yl]methylidene]but-3-ynenitrile.
| Compound Name | (2E)-2-[[1,1,3-trimethyl-6-[4-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)phenyl]inden-2-yl]methylidene]but-3-ynenitrile |
|---|---|
| PubChem CID | 155052962 |
| Molecular Formula | C36H25N3O |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | (2E)-2-[[1,1,3-trimethyl-6-[4-(16-oxa-2,8-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-1(9),3,5,7,10,12,14-heptaen-4-yl)phenyl]inden-2-yl]methylidene]but-3-ynenitrile |
| SMILES | C#C/C(C#N)=C\C1=C(C)c2ccc(-c3ccc(-c4ccc5nc6c7ccccc7oc6n5c4)cc3)cc2C1(C)C |
| InChI | InChI=1S/C36H25N3O/c1-5-23(20-37)18-30-22(2)28-16-14-26(19-31(28)36(30,3)4)24-10-12-25(13-11-24)27-15-17-33-38-34-29-8-6-7-9-32(29)40-35(34)39(33)21-27/h1,6-19,21H,2-4H3/b23-18+ |
| InChIKey | GTHMVDPTIUYVIE-PTGBLXJZSA-N |
| XLogP | 8.72 |
| TPSA | 54.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|