C39H30O — CID 142319517
1-[2,3-bis(ethenyl)-4-phenylnaphthalen-1-yl]-7-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran (PubChem CID 142319517) has the molecular formula C39H30O and a molecular weight of 514.67 g/mol. Its IUPAC name is 1-[2,3-bis(ethenyl)-4-phenylnaphthalen-1-yl]-7-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran.
| Compound Name | 1-[2,3-bis(ethenyl)-4-phenylnaphthalen-1-yl]-7-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran |
|---|---|
| PubChem CID | 142319517 |
| Molecular Formula | C39H30O |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 1-[2,3-bis(ethenyl)-4-phenylnaphthalen-1-yl]-7-[(2E,4Z)-hepta-2,4,6-trien-3-yl]dibenzofuran |
| SMILES | C=C/C=C\C(=C/C)c1ccc2c(c1)oc1cccc(-c3c(C=C)c(C=C)c(-c4ccccc4)c4ccccc34)c12 |
| InChI | InChI=1S/C39H30O/c1-5-9-16-26(6-2)28-23-24-33-36(25-28)40-35-22-15-21-34(39(33)35)38-30(8-4)29(7-3)37(27-17-11-10-12-18-27)31-19-13-14-20-32(31)38/h5-25H,1,3-4H2,2H3/b16-9-,26-6+ |
| InChIKey | IVECKCQTJZPFFK-UMGVPVGXSA-N |
| XLogP | 11.50 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|