C45H36O — CID 167067645
2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-2-[(Z)-prop-1-enyl]naphthalen-1-yl]-6,7-diphenyldibenzofuran (PubChem CID 167067645) has the molecular formula C45H36O and a molecular weight of 592.78 g/mol. Its IUPAC name is 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-2-[(Z)-prop-1-enyl]naphthalen-1-yl]-6,7-diphenyldibenzofuran.
| Compound Name | 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-2-[(Z)-prop-1-enyl]naphthalen-1-yl]-6,7-diphenyldibenzofuran |
|---|---|
| PubChem CID | 167067645 |
| Molecular Formula | C45H36O |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 2-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-methyl-2-[(Z)-prop-1-enyl]naphthalen-1-yl]-6,7-diphenyldibenzofuran |
| SMILES | C=C/C=C\C(=C/C)c1c(C)c(/C=C\C)c(-c2ccc3oc4c(-c5ccccc5)c(-c5ccccc5)ccc4c3c2)c2ccccc12 |
| InChI | InChI=1S/C45H36O/c1-5-8-18-31(7-3)42-30(4)35(17-6-2)43(38-24-16-15-23-37(38)42)34-25-28-41-40(29-34)39-27-26-36(32-19-11-9-12-20-32)44(45(39)46-41)33-21-13-10-14-22-33/h5-29H,1H2,2-4H3/b17-6-,18-8-,31-7+ |
| InChIKey | ORCAHBWUTTVMKC-RZOLLURTSA-N |
| XLogP | 13.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|