C45H32N4 — CID 155336979
N-[(1E,3Z)-2-[3-[6-(4-phenyl-1,10-phenanthrolin-2-yl)naphthalen-2-yl]-5-pyridin-3-ylphenyl]penta-1,3-dienyl]methanimine (PubChem CID 155336979) has the molecular formula C45H32N4 and a molecular weight of 628.78 g/mol. Its IUPAC name is N-[(1E,3Z)-2-[3-[6-(4-phenyl-1,10-phenanthrolin-2-yl)naphthalen-2-yl]-5-pyridin-3-ylphenyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-[3-[6-(4-phenyl-1,10-phenanthrolin-2-yl)naphthalen-2-yl]-5-pyridin-3-ylphenyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 155336979 |
| Molecular Formula | C45H32N4 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[(1E,3Z)-2-[3-[6-(4-phenyl-1,10-phenanthrolin-2-yl)naphthalen-2-yl]-5-pyridin-3-ylphenyl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)c1cc(-c2cccnc2)cc(-c2ccc3cc(-c4cc(-c5ccccc5)c5ccc6cccnc6c5n4)ccc3c2)c1 |
| InChI | InChI=1S/C45H32N4/c1-3-9-36(28-46-2)39-24-38(25-40(26-39)37-13-7-20-47-29-37)34-15-14-33-23-35(17-16-32(33)22-34)43-27-42(30-10-5-4-6-11-30)41-19-18-31-12-8-21-48-44(31)45(41)49-43/h3-29H,2H2,1H3/b9-3-,36-28+ |
| InChIKey | IJZLIGMHMVVZNI-VRYKDKSBSA-N |
| XLogP | 11.62 |
| TPSA | 51.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|