C20H29N — CID 144856705
(Z)-2-methylbut-2-en-1-imine;1-methyl-3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]benzene (PubChem CID 144856705) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (Z)-2-methylbut-2-en-1-imine;1-methyl-3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]benzene.
| Compound Name | (Z)-2-methylbut-2-en-1-imine;1-methyl-3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]benzene |
|---|---|
| PubChem CID | 144856705 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (Z)-2-methylbut-2-en-1-imine;1-methyl-3-[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]benzene |
| SMILES | C/C=C\C(=C/C(C)C)c1cccc(C)c1.[H]/N=C/C(C)=C\C |
| InChI | InChI=1S/C15H20.C5H9N/c1-5-7-14(10-12(2)3)15-9-6-8-13(4)11-15;1-3-5(2)4-6/h5-12H,1-4H3;3-4,6H,1-2H3/b7-5-,14-10+;5-3-,6-4+ |
| InChIKey | QMXAYUUVAJTPKC-QGBVNGBESA-N |
| XLogP | 6.21 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|