C23H30 — CID 144954093
benzene;1-[(2E,4Z)-4,7-dimethylocta-2,4-dien-2-yl]-3-methylbenzene (PubChem CID 144954093) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is benzene;1-[(2E,4Z)-4,7-dimethylocta-2,4-dien-2-yl]-3-methylbenzene.
| Compound Name | benzene;1-[(2E,4Z)-4,7-dimethylocta-2,4-dien-2-yl]-3-methylbenzene |
|---|---|
| PubChem CID | 144954093 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | benzene;1-[(2E,4Z)-4,7-dimethylocta-2,4-dien-2-yl]-3-methylbenzene |
| SMILES | CC(=C/CC(C)C)/C=C(\C)c1cccc(C)c1.c1ccccc1 |
| InChI | InChI=1S/C17H24.C6H6/c1-13(2)9-10-15(4)11-16(5)17-8-6-7-14(3)12-17;1-2-4-6-5-3-1/h6-8,10-13H,9H2,1-5H3;1-6H/b15-10-,16-11+; |
| InChIKey | WAJLJRIIRCARLS-DRGUHZJFSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|