About 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene
4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene (PubChem CID 145300542) has the molecular formula C25H36
and a molecular weight of 336.56 g/mol. Its IUPAC name is 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene |
| PubChem CID | 145300542 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene |
| SMILES | C/C(=C\c1ccccc1C)c1cccc(C)c1.CCCC(C)CCC |
| InChI | InChI=1S/C17H18.C8H18/c1-13-7-6-10-16(11-13)15(3)12-17-9-5-4-8-14(17)2;1-4-6-8(3)7-5-2/h4-12H,1-3H3;8H,4-7H2,1-3H3/b15-12+; |
| InChIKey | AAUQDNAGOFLEPQ-JRUHLWALSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene?
The IUPAC name of 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene (CID 145300542) is 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene.
What is the SMILES notation for 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene?
The canonical SMILES for 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene is C/C(=C\c1ccccc1C)c1cccc(C)c1.CCCC(C)CCC.
What is the InChIKey of 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene?
The InChIKey is AAUQDNAGOFLEPQ-JRUHLWALSA-N. The full InChI is InChI=1S/C17H18.C8H18/c1-13-7-6-10-16(11-13)15(3)12-17-9-5-4-8-14(17)2;1-4-6-8(3)7-5-2/h4-12H,1-3H3;8H,4-7H2,1-3H3/b15-12+;.
What are the key properties of 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene?
4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene has a molecular weight of 336.56 g/mol, XLogP of 8.09, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptane;1-methyl-2-[(E)-2-(3-methylphenyl)prop-1-enyl]benzene is sourced from PubChem (CID 145300542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).