C12H15NO — CID 143185658
prop-1-en-2-yl N,3-dimethylbenzenecarboximidate (PubChem CID 143185658) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is prop-1-en-2-yl N,3-dimethylbenzenecarboximidate.
| Compound Name | prop-1-en-2-yl N,3-dimethylbenzenecarboximidate |
|---|---|
| PubChem CID | 143185658 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | prop-1-en-2-yl N,3-dimethylbenzenecarboximidate |
| SMILES | C=C(C)O/C(=N\C)c1cccc(C)c1 |
| InChI | InChI=1S/C12H15NO/c1-9(2)14-12(13-4)11-7-5-6-10(3)8-11/h5-8H,1H2,2-4H3/b13-12- |
| InChIKey | RUURHXSAGGZZMG-SEYXRHQNSA-N |
| XLogP | 2.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|