C18H29N — CID 145022260
ethane;N-[(1Z)-3-(3-methylphenyl)buta-1,3-dienyl]propan-2-imine (PubChem CID 145022260) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is ethane;N-[(1Z)-3-(3-methylphenyl)buta-1,3-dienyl]propan-2-imine.
| Compound Name | ethane;N-[(1Z)-3-(3-methylphenyl)buta-1,3-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 145022260 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | ethane;N-[(1Z)-3-(3-methylphenyl)buta-1,3-dienyl]propan-2-imine |
| SMILES | C=C(/C=C\N=C(C)C)c1cccc(C)c1.CC.CC |
| InChI | InChI=1S/C14H17N.2C2H6/c1-11(2)15-9-8-13(4)14-7-5-6-12(3)10-14;2*1-2/h5-10H,4H2,1-3H3;2*1-2H3/b9-8-;; |
| InChIKey | ITSBLHFKFZCHOM-ULDSSAIZSA-N |
| XLogP | 6.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|