About prop-2-enoyl 3-aminobenzoate
prop-2-enoyl 3-aminobenzoate (PubChem CID 150356533) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is prop-2-enoyl 3-aminobenzoate.
Molecular Properties
| Compound Name | prop-2-enoyl 3-aminobenzoate |
| PubChem CID | 150356533 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | prop-2-enoyl 3-aminobenzoate |
| SMILES | C=CC(=O)OC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C10H9NO3/c1-2-9(12)14-10(13)7-4-3-5-8(11)6-7/h2-6H,1,11H2 |
| InChIKey | GUVFAFJFOWFLRT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoyl 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoyl 3-aminobenzoate?
The IUPAC name of prop-2-enoyl 3-aminobenzoate (CID 150356533) is prop-2-enoyl 3-aminobenzoate.
What is the SMILES notation for prop-2-enoyl 3-aminobenzoate?
The canonical SMILES for prop-2-enoyl 3-aminobenzoate is C=CC(=O)OC(=O)c1cccc(N)c1.
What is the InChIKey of prop-2-enoyl 3-aminobenzoate?
The InChIKey is GUVFAFJFOWFLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-2-9(12)14-10(13)7-4-3-5-8(11)6-7/h2-6H,1,11H2.
What are the key properties of prop-2-enoyl 3-aminobenzoate?
prop-2-enoyl 3-aminobenzoate has a molecular weight of 191.19 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoyl 3-aminobenzoate is sourced from PubChem (CID 150356533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).