C20H21N3 — CID 144691952
2-[(Z)-but-2-enyl]-4-cyclohexa-1,5-dien-1-yl-6-(4-methylphenyl)-1,3,5-triazine (PubChem CID 144691952) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[(Z)-but-2-enyl]-4-cyclohexa-1,5-dien-1-yl-6-(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-[(Z)-but-2-enyl]-4-cyclohexa-1,5-dien-1-yl-6-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144691952 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[(Z)-but-2-enyl]-4-cyclohexa-1,5-dien-1-yl-6-(4-methylphenyl)-1,3,5-triazine |
| SMILES | C/C=C\Cc1nc(C2=CCCC=C2)nc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H21N3/c1-3-4-10-18-21-19(16-8-6-5-7-9-16)23-20(22-18)17-13-11-15(2)12-14-17/h3-4,6,8-9,11-14H,5,7,10H2,1-2H3/b4-3- |
| InChIKey | RXJDHKKJZPJPNV-ARJAWSKDSA-N |
| XLogP | 4.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|