C26H20N2O — CID 166654648
4-[(E)-but-2-en-2-yl]-2-dibenzofuran-2-yl-6-phenylpyrimidine (PubChem CID 166654648) has the molecular formula C26H20N2O and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-2-dibenzofuran-2-yl-6-phenylpyrimidine.
| Compound Name | 4-[(E)-but-2-en-2-yl]-2-dibenzofuran-2-yl-6-phenylpyrimidine |
|---|---|
| PubChem CID | 166654648 |
| Molecular Formula | C26H20N2O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-2-dibenzofuran-2-yl-6-phenylpyrimidine |
| SMILES | C/C=C(\C)c1cc(-c2ccccc2)nc(-c2ccc3oc4ccccc4c3c2)n1 |
| InChI | InChI=1S/C26H20N2O/c1-3-17(2)22-16-23(18-9-5-4-6-10-18)28-26(27-22)19-13-14-25-21(15-19)20-11-7-8-12-24(20)29-25/h3-16H,1-2H3/b17-3+ |
| InChIKey | ZNDJCJXMZDSLBC-IJUHEHPCSA-N |
| XLogP | 7.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |