C23H17BrN2 — CID 134569476
2-(3-bromophenyl)-4-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-6-phenylpyrimidine (PubChem CID 134569476) has the molecular formula C23H17BrN2 and a molecular weight of 401.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-6-phenylpyrimidine.
| Compound Name | 2-(3-bromophenyl)-4-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 134569476 |
| Molecular Formula | C23H17BrN2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-(3-bromophenyl)-4-[(3E,5Z)-hepta-3,5-dien-1-yn-3-yl]-6-phenylpyrimidine |
| SMILES | C#C/C(=C\C=C/C)c1cc(-c2ccccc2)nc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C23H17BrN2/c1-3-5-10-17(4-2)21-16-22(18-11-7-6-8-12-18)26-23(25-21)19-13-9-14-20(24)15-19/h2-3,5-16H,1H3/b5-3-,17-10+ |
| InChIKey | VNHCGAKANVDSFZ-MSFFHYLASA-N |
| XLogP | 6.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|