C33H36S — CID 142828551
2-(9,10-dibutylanthracen-2-yl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]thiophene (PubChem CID 142828551) has the molecular formula C33H36S and a molecular weight of 464.72 g/mol. Its IUPAC name is 2-(9,10-dibutylanthracen-2-yl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]thiophene.
| Compound Name | 2-(9,10-dibutylanthracen-2-yl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]thiophene |
|---|---|
| PubChem CID | 142828551 |
| Molecular Formula | C33H36S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2-(9,10-dibutylanthracen-2-yl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]thiophene |
| SMILES | C=C(/C=C\C=C/C)c1ccc(-c2ccc3c(CCCC)c4ccccc4c(CCCC)c3c2)s1 |
| InChI | InChI=1S/C33H36S/c1-5-8-11-14-24(4)32-21-22-33(34-32)25-19-20-30-26(15-9-6-2)27-17-12-13-18-28(27)29(16-10-7-3)31(30)23-25/h5,8,11-14,17-23H,4,6-7,9-10,15-16H2,1-3H3/b8-5-,14-11- |
| InChIKey | KCBILFMEQBARLX-FRAOGEENSA-N |
| XLogP | 10.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|