C30H32S — CID 142828635
2-(9,10-dipropylanthracen-2-yl)-5-[(2Z,4Z)-hexa-2,4-dienyl]thiophene (PubChem CID 142828635) has the molecular formula C30H32S and a molecular weight of 424.65 g/mol. Its IUPAC name is 2-(9,10-dipropylanthracen-2-yl)-5-[(2Z,4Z)-hexa-2,4-dienyl]thiophene.
| Compound Name | 2-(9,10-dipropylanthracen-2-yl)-5-[(2Z,4Z)-hexa-2,4-dienyl]thiophene |
|---|---|
| PubChem CID | 142828635 |
| Molecular Formula | C30H32S |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-(9,10-dipropylanthracen-2-yl)-5-[(2Z,4Z)-hexa-2,4-dienyl]thiophene |
| SMILES | C/C=C\C=C/Cc1ccc(-c2ccc3c(CCC)c4ccccc4c(CCC)c3c2)s1 |
| InChI | InChI=1S/C30H32S/c1-4-7-8-9-14-23-18-20-30(31-23)22-17-19-28-24(12-5-2)26-15-10-11-16-27(26)25(13-6-3)29(28)21-22/h4,7-11,15-21H,5-6,12-14H2,1-3H3/b7-4-,9-8- |
| InChIKey | GXPOPCMOJIVWCR-UHWGBUKQSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|