C17H13ClN2S — CID 142314162
4-chloro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 142314162) has the molecular formula C17H13ClN2S and a molecular weight of 312.83 g/mol. Its IUPAC name is 4-chloro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-chloro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 142314162 |
| Molecular Formula | C17H13ClN2S |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-chloro-2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | C=C/C=C(\C=C/C)c1nc(Cl)c2sc3ccccc3c2n1 |
| InChI | InChI=1S/C17H13ClN2S/c1-3-7-11(8-4-2)17-19-14-12-9-5-6-10-13(12)21-15(14)16(18)20-17/h3-10H,1H2,2H3/b8-4-,11-7+ |
| InChIKey | YHLQEGYHOPURDP-USRDNGHPSA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|