C26H35FN2O2 — CID 176967889
1-(4-fluoro-3-methylphenyl)butyl butanoate;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyl-1H-pyrazole (PubChem CID 176967889) has the molecular formula C26H35FN2O2 and a molecular weight of 426.58 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)butyl butanoate;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyl-1H-pyrazole.
| Compound Name | 1-(4-fluoro-3-methylphenyl)butyl butanoate;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 176967889 |
| Molecular Formula | C26H35FN2O2 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)butyl butanoate;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyl-1H-pyrazole |
| SMILES | C=C/C=C(\C=C/C)c1cc(C)[nH]n1.CCCC(=O)OC(CCC)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C15H21FO2.C11H14N2/c1-4-6-14(18-15(17)7-5-2)12-8-9-13(16)11(3)10-12;1-4-6-10(7-5-2)11-8-9(3)12-13-11/h8-10,14H,4-7H2,1-3H3;4-8H,1H2,2-3H3,(H,12,13)/b;7-5-,10-6+ |
| InChIKey | XHQFRPKGFPFDPR-CONVLIDHSA-N |
| XLogP | 7.18 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|