C27H37ClN2O2 — CID 176967944
acetylene;1-(4-chloro-3-methylphenyl)butyl propanoate;5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-1H-pyrazole (PubChem CID 176967944) has the molecular formula C27H37ClN2O2 and a molecular weight of 457.06 g/mol. Its IUPAC name is acetylene;1-(4-chloro-3-methylphenyl)butyl propanoate;5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-1H-pyrazole.
| Compound Name | acetylene;1-(4-chloro-3-methylphenyl)butyl propanoate;5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 176967944 |
| Molecular Formula | C27H37ClN2O2 |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | acetylene;1-(4-chloro-3-methylphenyl)butyl propanoate;5-methyl-3-[(2E,4Z)-4-methylhexa-2,4-dien-3-yl]-1H-pyrazole |
| SMILES | C#C.C/C=C(C)\C(=C/C)c1cc(C)[nH]n1.CCCC(OC(=O)CC)c1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C14H19ClO2.C11H16N2.C2H2/c1-4-6-13(17-14(16)5-2)11-7-8-12(15)10(3)9-11;1-5-8(3)10(6-2)11-7-9(4)12-13-11;1-2/h7-9,13H,4-6H2,1-3H3;5-7H,1-4H3,(H,12,13);1-2H/b;8-5-,10-6+; |
| InChIKey | IUHQZPWCFGMZKM-JCRIFGICSA-N |
| XLogP | 7.78 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|