C9H16N2O2Si — CID 11975148
ethyl 5-trimethylsilyl-1H-pyrazole-3-carboxylate (PubChem CID 11975148) has the molecular formula C9H16N2O2Si and a molecular weight of 212.32 g/mol. Its IUPAC name is ethyl 5-trimethylsilyl-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-trimethylsilyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 11975148 |
| Molecular Formula | C9H16N2O2Si |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | ethyl 5-trimethylsilyl-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc([Si](C)(C)C)[nH]n1 |
| InChI | InChI=1S/C9H16N2O2Si/c1-5-13-9(12)7-6-8(11-10-7)14(2,3)4/h6H,5H2,1-4H3,(H,10,11) |
| InChIKey | RXCDGYSBSBEJHK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|