About ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate
ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate (PubChem CID 171800759) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate |
| PubChem CID | 171800759 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2C[C@H]2C)[nH]n1 |
| InChI | InChI=1S/C10H14N2O2/c1-3-14-10(13)9-5-8(11-12-9)7-4-6(7)2/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7-/m1/s1 |
| InChIKey | IFUPIDDSJGMWPB-RNFRBKRXSA-N |
| XLogP | 1.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate?
The IUPAC name of ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate (CID 171800759) is ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate?
The canonical SMILES for ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate is CCOC(=O)c1cc([C@@H]2C[C@H]2C)[nH]n1.
What is the InChIKey of ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate?
The InChIKey is IFUPIDDSJGMWPB-RNFRBKRXSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-3-14-10(13)9-5-8(11-12-9)7-4-6(7)2/h5-7H,3-4H2,1-2H3,(H,11,12)/t6-,7-/m1/s1.
What are the key properties of ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate?
ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate has a molecular weight of 194.23 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(1R,2R)-2-methylcyclopropyl]-1H-pyrazole-3-carboxylate is sourced from PubChem (CID 171800759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).