C20H28N4O4 — CID 162018519
5-cyclopentyl-1H-pyrazole-3-carboxylic acid;ethyl 5-cyclopentyl-1H-pyrazole-3-carboxylate (PubChem CID 162018519) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-cyclopentyl-1H-pyrazole-3-carboxylic acid;ethyl 5-cyclopentyl-1H-pyrazole-3-carboxylate.
| Compound Name | 5-cyclopentyl-1H-pyrazole-3-carboxylic acid;ethyl 5-cyclopentyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 162018519 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 5-cyclopentyl-1H-pyrazole-3-carboxylic acid;ethyl 5-cyclopentyl-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CCCC2)[nH]n1.O=C(O)c1cc(C2CCCC2)[nH]n1 |
| InChI | InChI=1S/C11H16N2O2.C9H12N2O2/c1-2-15-11(14)10-7-9(12-13-10)8-5-3-4-6-8;12-9(13)8-5-7(10-11-8)6-3-1-2-4-6/h7-8H,2-6H2,1H3,(H,12,13);5-6H,1-4H2,(H,10,11)(H,12,13) |
| InChIKey | YUKZZCWXDOLADI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |