C19H34N2O2Sn — CID 141081798
5-butylnonan-5-yl-(3-ethoxycarbonyl-1H-pyrazol-5-yl)tin (PubChem CID 141081798) has the molecular formula C19H34N2O2Sn and a molecular weight of 441.20 g/mol. Its IUPAC name is 5-butylnonan-5-yl-(3-ethoxycarbonyl-1H-pyrazol-5-yl)tin.
| Compound Name | 5-butylnonan-5-yl-(3-ethoxycarbonyl-1H-pyrazol-5-yl)tin |
|---|---|
| PubChem CID | 141081798 |
| Molecular Formula | C19H34N2O2Sn |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 5-butylnonan-5-yl-(3-ethoxycarbonyl-1H-pyrazol-5-yl)tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1cc(C(=O)OCC)n[nH]1 |
| InChI | InChI=1S/C13H27.C6H7N2O2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-10-6(9)5-3-4-7-8-5;/h4-12H2,1-3H3;3H,2H2,1H3,(H,7,8); |
| InChIKey | JTZXMDIGMPINOB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |