C15H26N2O2Si — CID 150892596
ethyl 5-[3-[2,2-dimethylpropyl(methyl)silylidene]propyl]-1H-pyrazole-3-carboxylate (PubChem CID 150892596) has the molecular formula C15H26N2O2Si and a molecular weight of 294.47 g/mol. Its IUPAC name is ethyl 5-[3-[2,2-dimethylpropyl(methyl)silylidene]propyl]-1H-pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[2,2-dimethylpropyl(methyl)silylidene]propyl]-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 150892596 |
| Molecular Formula | C15H26N2O2Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl 5-[3-[2,2-dimethylpropyl(methyl)silylidene]propyl]-1H-pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CCC=[Si](C)CC(C)(C)C)[nH]n1 |
| InChI | InChI=1S/C15H26N2O2Si/c1-6-19-14(18)13-10-12(16-17-13)8-7-9-20(5)11-15(2,3)4/h9-10H,6-8,11H2,1-5H3,(H,16,17) |
| InChIKey | KYIFNBRFSQCBKQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|