C13H21N3O3 — CID 55601702
[2-[methyl(propan-2-yl)amino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate (PubChem CID 55601702) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate.
| Compound Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55601702 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | [2-[methyl(propan-2-yl)amino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)N(C)C(C)C)n[nH]1 |
| InChI | InChI=1S/C13H21N3O3/c1-5-6-10-7-11(15-14-10)13(18)19-8-12(17)16(4)9(2)3/h7,9H,5-6,8H2,1-4H3,(H,14,15) |
| InChIKey | PWUQYYFTYFFHLR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |