C17H20BrN3O3 — CID 55546783
[2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate (PubChem CID 55546783) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate.
| Compound Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55546783 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | [2-[(2-bromophenyl)methyl-methylamino]-2-oxoethyl] 5-propyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)N(C)Cc2ccccc2Br)n[nH]1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-3-6-13-9-15(20-19-13)17(23)24-11-16(22)21(2)10-12-7-4-5-8-14(12)18/h4-5,7-9H,3,6,10-11H2,1-2H3,(H,19,20) |
| InChIKey | UYFUJNCGZQAPBZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |