C10H14O2 — CID 139967113
hexa-2,4-dienyl (E)-but-2-enoate (PubChem CID 139967113) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is hexa-2,4-dienyl (E)-but-2-enoate.
| Compound Name | hexa-2,4-dienyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 139967113 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | hexa-2,4-dienyl (E)-but-2-enoate |
| SMILES | CC=CC=CCOC(=O)/C=C/C |
| InChI | InChI=1S/C10H14O2/c1-3-5-6-7-9-12-10(11)8-4-2/h3-8H,9H2,1-2H3/b5-3?,7-6?,8-4+ |
| InChIKey | GRIQVJDRCQPNRS-HNYXWLHWSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|