About [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate
[(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate (PubChem CID 173248940) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate.
Molecular Properties
| Compound Name | [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate |
| PubChem CID | 173248940 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate |
| SMILES | C/C=C/C(=O)OCC=CC(=O)OC(=O)/C=C/C |
| InChI | InChI=1S/C12H14O5/c1-3-6-10(13)16-9-5-8-12(15)17-11(14)7-4-2/h3-8H,9H2,1-2H3/b6-3+,7-4+,8-5? |
| InChIKey | ALJXKKPHEQSANF-PAUSFFEXSA-N |
| XLogP | 1.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate?
The IUPAC name of [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate (CID 173248940) is [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate.
What is the SMILES notation for [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate?
The canonical SMILES for [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate is C/C=C/C(=O)OCC=CC(=O)OC(=O)/C=C/C.
What is the InChIKey of [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate?
The InChIKey is ALJXKKPHEQSANF-PAUSFFEXSA-N. The full InChI is InChI=1S/C12H14O5/c1-3-6-10(13)16-9-5-8-12(15)17-11(14)7-4-2/h3-8H,9H2,1-2H3/b6-3+,7-4+,8-5?.
What are the key properties of [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate?
[(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate has a molecular weight of 238.24 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enoyl] 4-[(E)-but-2-enoyl]oxybut-2-enoate is sourced from PubChem (CID 173248940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).