About 1-hydroxyethenyl (E)-but-2-enoate
1-hydroxyethenyl (E)-but-2-enoate (PubChem CID 141389203) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 1-hydroxyethenyl (E)-but-2-enoate.
Molecular Properties
| Compound Name | 1-hydroxyethenyl (E)-but-2-enoate |
| PubChem CID | 141389203 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 1-hydroxyethenyl (E)-but-2-enoate |
| SMILES | C=C(O)OC(=O)/C=C/C |
| InChI | InChI=1S/C6H8O3/c1-3-4-6(8)9-5(2)7/h3-4,7H,2H2,1H3/b4-3+ |
| InChIKey | KOIAMJRPOCZHKE-ONEGZZNKSA-N |
| XLogP | 1.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethenyl (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethenyl (E)-but-2-enoate?
The IUPAC name of 1-hydroxyethenyl (E)-but-2-enoate (CID 141389203) is 1-hydroxyethenyl (E)-but-2-enoate.
What is the SMILES notation for 1-hydroxyethenyl (E)-but-2-enoate?
The canonical SMILES for 1-hydroxyethenyl (E)-but-2-enoate is C=C(O)OC(=O)/C=C/C.
What is the InChIKey of 1-hydroxyethenyl (E)-but-2-enoate?
The InChIKey is KOIAMJRPOCZHKE-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H8O3/c1-3-4-6(8)9-5(2)7/h3-4,7H,2H2,1H3/b4-3+.
What are the key properties of 1-hydroxyethenyl (E)-but-2-enoate?
1-hydroxyethenyl (E)-but-2-enoate has a molecular weight of 128.13 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethenyl (E)-but-2-enoate is sourced from PubChem (CID 141389203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).