C14H30NO5PSSi — CID 176598793
2-trimethylsilylethyl 3-(diethoxyphosphorylmethylsulfanyl)azetidine-1-carboxylate (PubChem CID 176598793) has the molecular formula C14H30NO5PSSi and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-(diethoxyphosphorylmethylsulfanyl)azetidine-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-(diethoxyphosphorylmethylsulfanyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 176598793 |
| Molecular Formula | C14H30NO5PSSi |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-trimethylsilylethyl 3-(diethoxyphosphorylmethylsulfanyl)azetidine-1-carboxylate |
| SMILES | CCOP(=O)(CSC1CN(C(=O)OCC[Si](C)(C)C)C1)OCC |
| InChI | InChI=1S/C14H30NO5PSSi/c1-6-19-21(17,20-7-2)12-22-13-10-15(11-13)14(16)18-8-9-23(3,4)5/h13H,6-12H2,1-5H3 |
| InChIKey | MHZRLGBMVAVIJT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|