C13H26N2O4Si — CID 132594141
3-(propylamino)-1-(2-trimethylsilylethoxycarbonyl)azetidine-3-carboxylic acid (PubChem CID 132594141) has the molecular formula C13H26N2O4Si and a molecular weight of 302.45 g/mol. Its IUPAC name is 3-(propylamino)-1-(2-trimethylsilylethoxycarbonyl)azetidine-3-carboxylic acid.
| Compound Name | 3-(propylamino)-1-(2-trimethylsilylethoxycarbonyl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 132594141 |
| Molecular Formula | C13H26N2O4Si |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-(propylamino)-1-(2-trimethylsilylethoxycarbonyl)azetidine-3-carboxylic acid |
| SMILES | CCCNC1(C(=O)O)CN(C(=O)OCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O4Si/c1-5-6-14-13(11(16)17)9-15(10-13)12(18)19-7-8-20(2,3)4/h14H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | SMVFBSUAMSVCDP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|