C14H28N2O2Si — CID 164554342
2-trimethylsilylethyl (4aR,8aR)-2,3,4,4a,5,6,8,8a-octahydro-1H-1,7-naphthyridine-7-carboxylate (PubChem CID 164554342) has the molecular formula C14H28N2O2Si and a molecular weight of 284.48 g/mol. Its IUPAC name is 2-trimethylsilylethyl (4aR,8aR)-2,3,4,4a,5,6,8,8a-octahydro-1H-1,7-naphthyridine-7-carboxylate.
| Compound Name | 2-trimethylsilylethyl (4aR,8aR)-2,3,4,4a,5,6,8,8a-octahydro-1H-1,7-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 164554342 |
| Molecular Formula | C14H28N2O2Si |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-trimethylsilylethyl (4aR,8aR)-2,3,4,4a,5,6,8,8a-octahydro-1H-1,7-naphthyridine-7-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)N1CC[C@H]2CCCN[C@H]2C1 |
| InChI | InChI=1S/C14H28N2O2Si/c1-19(2,3)10-9-18-14(17)16-8-6-12-5-4-7-15-13(12)11-16/h12-13,15H,4-11H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | UYHGRPURAXTSMI-OLZOCXBDSA-N |
| XLogP | 2.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|