C11H20N2O2 — CID 83848939
methyl 1,2,3,4,4a,5,6,8,9,9a-decahydropyrido[2,3-d]azepine-7-carboxylate (PubChem CID 83848939) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl 1,2,3,4,4a,5,6,8,9,9a-decahydropyrido[2,3-d]azepine-7-carboxylate.
| Compound Name | methyl 1,2,3,4,4a,5,6,8,9,9a-decahydropyrido[2,3-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 83848939 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | methyl 1,2,3,4,4a,5,6,8,9,9a-decahydropyrido[2,3-d]azepine-7-carboxylate |
| SMILES | COC(=O)N1CCC2CCCNC2CC1 |
| InChI | InChI=1S/C11H20N2O2/c1-15-11(14)13-7-4-9-3-2-6-12-10(9)5-8-13/h9-10,12H,2-8H2,1H3 |
| InChIKey | IPJYPIVGELRWCU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |