C12H22N2O4S — CID 63259471
methyl 2-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylacetate (PubChem CID 63259471) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is methyl 2-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylacetate.
| Compound Name | methyl 2-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylacetate |
|---|---|
| PubChem CID | 63259471 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 2-(4-pyrrolidin-2-ylpiperidin-1-yl)sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)N1CCC(C2CCCN2)CC1 |
| InChI | InChI=1S/C12H22N2O4S/c1-18-12(15)9-19(16,17)14-7-4-10(5-8-14)11-3-2-6-13-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | STNRRWLEWDRWPZ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |