C12H22N2O3 — CID 118142587
butyl 2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate (PubChem CID 118142587) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is butyl 2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate.
| Compound Name | butyl 2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 118142587 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | butyl 2,3,4,4a,5,7,8,8a-octahydropyrido[4,3-b][1,4]oxazine-6-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2OCCNC2C1 |
| InChI | InChI=1S/C12H22N2O3/c1-2-3-7-17-12(15)14-6-4-11-10(9-14)13-5-8-16-11/h10-11,13H,2-9H2,1H3 |
| InChIKey | FIPKHDPBNCSRBY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|