C11H20NO4P — CID 134860935
(E)-N-cyclopropyl-4-diethoxyphosphorylbut-2-enamide (PubChem CID 134860935) has the molecular formula C11H20NO4P and a molecular weight of 261.26 g/mol. Its IUPAC name is (E)-N-cyclopropyl-4-diethoxyphosphorylbut-2-enamide.
| Compound Name | (E)-N-cyclopropyl-4-diethoxyphosphorylbut-2-enamide |
|---|---|
| PubChem CID | 134860935 |
| Molecular Formula | C11H20NO4P |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (E)-N-cyclopropyl-4-diethoxyphosphorylbut-2-enamide |
| SMILES | CCOP(=O)(C/C=C/C(=O)NC1CC1)OCC |
| InChI | InChI=1S/C11H20NO4P/c1-3-15-17(14,16-4-2)9-5-6-11(13)12-10-7-8-10/h5-6,10H,3-4,7-9H2,1-2H3,(H,12,13)/b6-5+ |
| InChIKey | OHURZFNOKBTZRL-AATRIKPKSA-N |
| XLogP | 2.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|