C21H33NO5 — CID 145340266
tert-butyl [3-(2,5-dimethylphenyl)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate (PubChem CID 145340266) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl [3-(2,5-dimethylphenyl)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate.
| Compound Name | tert-butyl [3-(2,5-dimethylphenyl)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
|---|---|
| PubChem CID | 145340266 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | tert-butyl [3-(2,5-dimethylphenyl)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] carbonate |
| SMILES | Cc1ccc(C)c(CCCN(OC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H33NO5/c1-15-11-12-16(2)17(14-15)10-9-13-22(18(23)25-20(3,4)5)27-19(24)26-21(6,7)8/h11-12,14H,9-10,13H2,1-8H3 |
| InChIKey | JFMPUGWOWPUECR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|