C12H20ClNO2 — CID 102520805
tert-butyl N-[2-(chloromethyl)prop-2-enyl]-N-prop-2-enylcarbamate (PubChem CID 102520805) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is tert-butyl N-[2-(chloromethyl)prop-2-enyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[2-(chloromethyl)prop-2-enyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 102520805 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | tert-butyl N-[2-(chloromethyl)prop-2-enyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CC(=C)CCl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20ClNO2/c1-6-7-14(9-10(2)8-13)11(15)16-12(3,4)5/h6H,1-2,7-9H2,3-5H3 |
| InChIKey | DSUSTYREANKQEW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|