C22H40N2O4 — CID 169090818
dicyclohexylazanium;2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]acetate (PubChem CID 169090818) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is dicyclohexylazanium;2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]acetate.
| Compound Name | dicyclohexylazanium;2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]acetate |
|---|---|
| PubChem CID | 169090818 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | dicyclohexylazanium;2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-enylamino]acetate |
| SMILES | C1CCC([NH2+]C2CCCCC2)CC1.C=CCN(CC(=O)[O-])C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23N.C10H17NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-6-11(7-8(12)13)9(14)15-10(2,3)4/h11-13H,1-10H2;5H,1,6-7H2,2-4H3,(H,12,13) |
| InChIKey | QZLCAJXYWFQXKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|