C12H26N4O4 — CID 173132069
2-(2,2-diaminoacetyl)oxyethyl 2,2-diaminoacetate;ethene (PubChem CID 173132069) has the molecular formula C12H26N4O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(2,2-diaminoacetyl)oxyethyl 2,2-diaminoacetate;ethene.
| Compound Name | 2-(2,2-diaminoacetyl)oxyethyl 2,2-diaminoacetate;ethene |
|---|---|
| PubChem CID | 173132069 |
| Molecular Formula | C12H26N4O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-(2,2-diaminoacetyl)oxyethyl 2,2-diaminoacetate;ethene |
| SMILES | C=C.C=C.C=C.NC(N)C(=O)OCCOC(=O)C(N)N |
| InChI | InChI=1S/C6H14N4O4.3C2H4/c7-3(8)5(11)13-1-2-14-6(12)4(9)10;3*1-2/h3-4H,1-2,7-10H2;3*1-2H2 |
| InChIKey | RTQZLSSRMMREAQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 156.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|