C17H26Br4O8 — CID 88920801
2-(2-bromopropanoyloxy)ethyl 2-bromopropanoate;2,6-dibromoheptanedioic acid;ethene (PubChem CID 88920801) has the molecular formula C17H26Br4O8 and a molecular weight of 678.00 g/mol. Its IUPAC name is 2-(2-bromopropanoyloxy)ethyl 2-bromopropanoate;2,6-dibromoheptanedioic acid;ethene.
| Compound Name | 2-(2-bromopropanoyloxy)ethyl 2-bromopropanoate;2,6-dibromoheptanedioic acid;ethene |
|---|---|
| PubChem CID | 88920801 |
| Molecular Formula | C17H26Br4O8 |
| Molecular Weight | 678.00 g/mol |
| Exact Mass | 673.84 |
| IUPAC Name | 2-(2-bromopropanoyloxy)ethyl 2-bromopropanoate;2,6-dibromoheptanedioic acid;ethene |
| SMILES | C=C.CC(Br)C(=O)OCCOC(=O)C(C)Br.O=C(O)C(Br)CCCC(Br)C(=O)O |
| InChI | InChI=1S/C8H12Br2O4.C7H10Br2O4.C2H4/c1-5(9)7(11)13-3-4-14-8(12)6(2)10;8-4(6(10)11)2-1-3-5(9)7(12)13;1-2/h5-6H,3-4H2,1-2H3;4-5H,1-3H2,(H,10,11)(H,12,13);1-2H2 |
| InChIKey | YUIBQFUGGCEYMW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|