C12H19NO — CID 89089024
N-(2-buta-1,3-dien-2-yloxyethyl)-N-prop-2-enylprop-2-en-1-amine (PubChem CID 89089024) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2-buta-1,3-dien-2-yloxyethyl)-N-prop-2-enylprop-2-en-1-amine.
| Compound Name | N-(2-buta-1,3-dien-2-yloxyethyl)-N-prop-2-enylprop-2-en-1-amine |
|---|---|
| PubChem CID | 89089024 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(2-buta-1,3-dien-2-yloxyethyl)-N-prop-2-enylprop-2-en-1-amine |
| SMILES | C=CCN(CC=C)CCOC(=C)C=C |
| InChI | InChI=1S/C12H19NO/c1-5-8-13(9-6-2)10-11-14-12(4)7-3/h5-7H,1-4,8-11H2 |
| InChIKey | GDYQNWHCMFDBOC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|