C13H21NO5 — CID 142004831
2-[5-buta-1,3-dien-2-yloxypentyl(carboxymethyl)amino]acetic acid (PubChem CID 142004831) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[5-buta-1,3-dien-2-yloxypentyl(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[5-buta-1,3-dien-2-yloxypentyl(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 142004831 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[5-buta-1,3-dien-2-yloxypentyl(carboxymethyl)amino]acetic acid |
| SMILES | C=CC(=C)OCCCCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H21NO5/c1-3-11(2)19-8-6-4-5-7-14(9-12(15)16)10-13(17)18/h3H,1-2,4-10H2,(H,15,16)(H,17,18) |
| InChIKey | IJDPQACXIVULEC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|