C28H46N4O10 — CID 87619477
2-[2-[bis[2-[5-(2-methylprop-2-enoylamino)pentoxy]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 87619477) has the molecular formula C28H46N4O10 and a molecular weight of 598.69 g/mol. Its IUPAC name is 2-[2-[bis[2-[5-(2-methylprop-2-enoylamino)pentoxy]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[bis[2-[5-(2-methylprop-2-enoylamino)pentoxy]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 87619477 |
| Molecular Formula | C28H46N4O10 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 2-[2-[bis[2-[5-(2-methylprop-2-enoylamino)pentoxy]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | C=C(C)C(=O)NCCCCCOC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)OCCCCCNC(=O)C(=C)C |
| InChI | InChI=1S/C28H46N4O10/c1-21(2)27(39)29-11-7-5-9-15-41-25(37)19-32(14-13-31(17-23(33)34)18-24(35)36)20-26(38)42-16-10-6-8-12-30-28(40)22(3)4/h1,3,5-20H2,2,4H3,(H,29,39)(H,30,40)(H,33,34)(H,35,36) |
| InChIKey | BMHHDOSYOHKLET-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 191.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|