C24H35N3O14 — CID 134355041
2-[bis[2-[carboxymethyl-[2-oxo-2-(2-prop-2-enoyloxyethoxy)ethyl]amino]ethyl]amino]acetic acid (PubChem CID 134355041) has the molecular formula C24H35N3O14 and a molecular weight of 589.55 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-(2-prop-2-enoyloxyethoxy)ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(2-prop-2-enoyloxyethoxy)ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 134355041 |
| Molecular Formula | C24H35N3O14 |
| Molecular Weight | 589.55 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(2-prop-2-enoyloxyethoxy)ethyl]amino]ethyl]amino]acetic acid |
| SMILES | C=CC(=O)OCCOC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)OCCOC(=O)C=C)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C24H35N3O14/c1-3-21(34)38-9-11-40-23(36)16-26(14-19(30)31)7-5-25(13-18(28)29)6-8-27(15-20(32)33)17-24(37)41-12-10-39-22(35)4-2/h3-4H,1-2,5-17H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | HICYDGPUXURRJN-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 226.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.55 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|