C14H24N2O9 — CID 174960302
2-[carboxymethyl-[2-[carboxymethyl-[2-(2-ethoxyethoxy)-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 174960302) has the molecular formula C14H24N2O9 and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl-[2-(2-ethoxyethoxy)-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-(2-ethoxyethoxy)-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 174960302 |
| Molecular Formula | C14H24N2O9 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-(2-ethoxyethoxy)-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | CCOCCOC(=O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H24N2O9/c1-2-24-5-6-25-14(23)10-16(9-13(21)22)4-3-15(7-11(17)18)8-12(19)20/h2-10H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | MIOQHMYOEJXMRG-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|