C18H33N3O8 — CID 91576215
2-[carboxymethyl-[2-[2-[carboxymethyl-(2-hexoxy-2-oxoethyl)amino]ethylamino]ethyl]amino]acetic acid (PubChem CID 91576215) has the molecular formula C18H33N3O8 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[2-[carboxymethyl-(2-hexoxy-2-oxoethyl)amino]ethylamino]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[2-[carboxymethyl-(2-hexoxy-2-oxoethyl)amino]ethylamino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 91576215 |
| Molecular Formula | C18H33N3O8 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 2-[carboxymethyl-[2-[2-[carboxymethyl-(2-hexoxy-2-oxoethyl)amino]ethylamino]ethyl]amino]acetic acid |
| SMILES | CCCCCCOC(=O)CN(CCNCCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C18H33N3O8/c1-2-3-4-5-10-29-18(28)14-21(13-17(26)27)9-7-19-6-8-20(11-15(22)23)12-16(24)25/h19H,2-14H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | LNYAENIRXTVOPE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 156.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|