C14H26N2O6 — CID 130186737
2-[carboxymethyl-[8-(ethenylperoxyamino)octyl]amino]acetic acid (PubChem CID 130186737) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[carboxymethyl-[8-(ethenylperoxyamino)octyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[8-(ethenylperoxyamino)octyl]amino]acetic acid |
|---|---|
| PubChem CID | 130186737 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[carboxymethyl-[8-(ethenylperoxyamino)octyl]amino]acetic acid |
| SMILES | C=COONCCCCCCCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H26N2O6/c1-2-21-22-15-9-7-5-3-4-6-8-10-16(11-13(17)18)12-14(19)20/h2,15H,1,3-12H2,(H,17,18)(H,19,20) |
| InChIKey | LSRKIRFPCCHHJW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|