C10H16N2O — CID 108910247
3-prop-1-en-2-yl-1,1-bis(prop-2-enyl)urea (PubChem CID 108910247) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-prop-1-en-2-yl-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 108910247 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-prop-1-en-2-yl-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NC(=C)C |
| InChI | InChI=1S/C10H16N2O/c1-5-7-12(8-6-2)10(13)11-9(3)4/h5-6H,1-3,7-8H2,4H3,(H,11,13) |
| InChIKey | FRGRSWKCQNFDMI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|