C12H20N2O — CID 108902716
3-cyclopentyl-1,1-bis(prop-2-enyl)urea (PubChem CID 108902716) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-cyclopentyl-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 108902716 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 3-cyclopentyl-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-9-14(10-4-2)12(15)13-11-7-5-6-8-11/h3-4,11H,1-2,5-10H2,(H,13,15) |
| InChIKey | YWTRWOZKZKHNEV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|