C10H14N4O — CID 116653843
1,1-bis(cyanomethyl)-3-cyclopentylurea (PubChem CID 116653843) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 1,1-bis(cyanomethyl)-3-cyclopentylurea.
| Compound Name | 1,1-bis(cyanomethyl)-3-cyclopentylurea |
|---|---|
| PubChem CID | 116653843 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 1,1-bis(cyanomethyl)-3-cyclopentylurea |
| SMILES | N#CCN(CC#N)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H14N4O/c11-5-7-14(8-6-12)10(15)13-9-3-1-2-4-9/h9H,1-4,7-8H2,(H,13,15) |
| InChIKey | HNYLDRSHMUOUFA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|